Brickellin
|
|
| Names
|
| IUPAC name
2′,5-Dihydroxy-3,4′,5′,6,7-pentamethoxyflavone
|
Systematic IUPAC name
5-Hydroxy-2-(2-hydroxy-4,5-dimethoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C20H20O9/c1-24-11-6-9(10(21)7-12(11)25-2)18-20(28-5)17(23)15-13(29-18)8-14(26-3)19(27-4)16(15)22/h6-8,21-22H,1-5H3 Y Key: USWPTYUGAMOLAB-UHFFFAOYSA-N Y InChI=1/C20H20O9/c1-24-11-6-9(10(21)7-12(11)25-2)18-20(28-5)17(23)15-13(29-18)8-14(26-3)19(27-4)16(15)22/h6-8,21-22H,1-5H3 Key: USWPTYUGAMOLAB-UHFFFAOYAR
|
COc3cc(C=1Oc2cc(OC)c(OC)c(O)c2C(=O)C=1OC)c(O)cc3OC
|
| Properties
|
|
|
C20H20O9
|
| Molar mass
|
404.371 g·mol−1
|
| Density
|
1.443 g/mL
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Brickellin is an O-methylated flavonol.[1] It can be found in Brickellia veronicifolia.[2]
References
- ^ Iinuma, M (1985). "Synthesis and revised structure of the flavone brickellin". Phytochemistry. 24 (6): 1367–1368. Bibcode:1985PChem..24.1367I. doi:10.1016/S0031-9422(00)81135-8.
- ^ Brickellin, a novel flavone from Brickellia veronicaefolia and B. chlorolepis. Roberts M. F., Timmermann B. N., Mabry T. J., Brown R. and Matlin S. A., Phytochemistry, 1984, volume 23, no 1, pages 163-165, INIST 9471694
Flavonols and their conjugates |
|---|
| Backbone | |
|---|
| Flavonols | | Aglycones | |
|---|
| Conjugates | | Glycosides of herbacetin | |
|---|
| Glycosides of kaempferol |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| Glycosides of myricetin | |
|---|
| Conjugates of quercetin | |
|---|
|
|---|
|
|---|
| O-Methylated flavonols | | Aglycones | |
|---|
| Glycosides | | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| Derivative flavonols | | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| Pyranoflavonols | |
|---|
| Furanoflavonols | |
|---|
| Semisynthetic | |
|---|
Category |